About N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide
N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide (PubChem CID 161343913) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide |
| PubChem CID | 161343913 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide |
| SMILES | [H]/N=C(\N(C)CCO)C(C)(C)C |
| InChI | InChI=1S/C8H18N2O/c1-8(2,3)7(9)10(4)5-6-11/h9,11H,5-6H2,1-4H3/b9-7- |
| InChIKey | SJVHXVCLWZTFQV-CLFYSBASSA-N |
| XLogP | 0.93 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide?
The IUPAC name of N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide (CID 161343913) is N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide.
What is the SMILES notation for N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide?
The canonical SMILES for N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide is [H]/N=C(\N(C)CCO)C(C)(C)C.
What is the InChIKey of N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide?
The InChIKey is SJVHXVCLWZTFQV-CLFYSBASSA-N. The full InChI is InChI=1S/C8H18N2O/c1-8(2,3)7(9)10(4)5-6-11/h9,11H,5-6H2,1-4H3/b9-7-.
What are the key properties of N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide?
N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide has a molecular weight of 158.24 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-N,2,2-trimethylpropanimidamide is sourced from PubChem (CID 161343913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).