C27H33BrN2O — CID 161345236
3-[(4S,6S,8S)-5-(2-methoxyethyl)-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile bromide (PubChem CID 161345236) has the molecular formula C27H33BrN2O and a molecular weight of 481.48 g/mol. Its IUPAC name is 3-[(4S,6S,8S)-5-(2-methoxyethyl)-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile bromide.
| Compound Name | 3-[(4S,6S,8S)-5-(2-methoxyethyl)-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile bromide |
|---|---|
| PubChem CID | 161345236 |
| Molecular Formula | C27H33BrN2O |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 3-[(4S,6S,8S)-5-(2-methoxyethyl)-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile bromide |
| SMILES | COCC[N+]1(C)[C@H]2CCC23C[C@@H](CC(C#N)(c2ccccc2)c2ccccc2)C[C@@H]31.[Br-] |
| InChI | InChI=1S/C27H33N2O.BrH/c1-29(15-16-30-2)24-13-14-26(24)18-21(17-25(26)29)19-27(20-28,22-9-5-3-6-10-22)23-11-7-4-8-12-23;/h3-12,21,24-25H,13-19H2,1-2H3;1H/q+1;/p-1/t21-,24-,25-,26?,29?;/m0./s1 |
| InChIKey | BMIPFZPVEBQYJR-UDIURMFESA-M |
| XLogP | 1.92 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|