About acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one
acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 161345359) has the molecular formula C19H23FN2O6
and a molecular weight of 394.40 g/mol. Its IUPAC name is acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one |
| PubChem CID | 161345359 |
| Molecular Formula | C19H23FN2O6 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=O)N1CCC(c2cc(F)c3c(c2)NC(=O)[C@@H](C)O3)C1.CC(=O)OC(C)=O |
| InChI | InChI=1S/C15H17FN2O3.C4H6O3/c1-8-15(20)17-13-6-11(5-12(16)14(13)21-8)10-3-4-18(7-10)9(2)19;1-3(5)7-4(2)6/h5-6,8,10H,3-4,7H2,1-2H3,(H,17,20);1-2H3/t8-,10?;/m1./s1 |
| InChIKey | VNFHELNOUDCBBW-GLXCQHJISA-N |
| XLogP | 1.98 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one?
The IUPAC name of acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one (CID 161345359) is acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one?
The canonical SMILES for acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one is CC(=O)N1CCC(c2cc(F)c3c(c2)NC(=O)[C@@H](C)O3)C1.CC(=O)OC(C)=O.
What is the InChIKey of acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one?
The InChIKey is VNFHELNOUDCBBW-GLXCQHJISA-N. The full InChI is InChI=1S/C15H17FN2O3.C4H6O3/c1-8-15(20)17-13-6-11(5-12(16)14(13)21-8)10-3-4-18(7-10)9(2)19;1-3(5)7-4(2)6/h5-6,8,10H,3-4,7H2,1-2H3,(H,17,20);1-2H3/t8-,10?;/m1./s1.
What are the key properties of acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one?
acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one has a molecular weight of 394.40 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl acetate;(2R)-6-(1-acetylpyrrolidin-3-yl)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 161345359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).