About 2-pyrimidin-2-ylphenol;zinc
2-pyrimidin-2-ylphenol;zinc (PubChem CID 161346901) has the molecular formula C10H8N2OZn
and a molecular weight of 237.58 g/mol. Its IUPAC name is 2-pyrimidin-2-ylphenol;zinc.
Molecular Properties
| Compound Name | 2-pyrimidin-2-ylphenol;zinc |
| PubChem CID | 161346901 |
| Molecular Formula | C10H8N2OZn |
| Molecular Weight | 237.58 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 2-pyrimidin-2-ylphenol;zinc |
| SMILES | Oc1ccccc1-c1ncccn1.[Zn] |
| InChI | InChI=1S/C10H8N2O.Zn/c13-9-5-2-1-4-8(9)10-11-6-3-7-12-10;/h1-7,13H; |
| InChIKey | VNKRANLKLKJTJF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.58 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrimidin-2-ylphenol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrimidin-2-ylphenol;zinc?
The IUPAC name of 2-pyrimidin-2-ylphenol;zinc (CID 161346901) is 2-pyrimidin-2-ylphenol;zinc.
What is the SMILES notation for 2-pyrimidin-2-ylphenol;zinc?
The canonical SMILES for 2-pyrimidin-2-ylphenol;zinc is Oc1ccccc1-c1ncccn1.[Zn].
What is the InChIKey of 2-pyrimidin-2-ylphenol;zinc?
The InChIKey is VNKRANLKLKJTJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O.Zn/c13-9-5-2-1-4-8(9)10-11-6-3-7-12-10;/h1-7,13H;.
What are the key properties of 2-pyrimidin-2-ylphenol;zinc?
2-pyrimidin-2-ylphenol;zinc has a molecular weight of 237.58 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-2-ylphenol;zinc is sourced from PubChem (CID 161346901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).