C38H41Cl3N4O7S2 — CID 161348186
8-chloro-7-(2,2-dimethoxyethoxy)-2-(4-propan-2-yl-1,3-thiazol-2-yl)-1H-quinolin-4-one;2-[4,8-dichloro-7-(2,2-dimethoxyethoxy)quinolin-2-yl]-4-propan-2-yl-1,3-thiazole (PubChem CID 161348186) has the molecular formula C38H41Cl3N4O7S2 and a molecular weight of 836.26 g/mol. Its IUPAC name is 8-chloro-7-(2,2-dimethoxyethoxy)-2-(4-propan-2-yl-1,3-thiazol-2-yl)-1H-quinolin-4-one;2-[4,8-dichloro-7-(2,2-dimethoxyethoxy)quinolin-2-yl]-4-propan-2-yl-1,3-thiazole.
| Compound Name | 8-chloro-7-(2,2-dimethoxyethoxy)-2-(4-propan-2-yl-1,3-thiazol-2-yl)-1H-quinolin-4-one;2-[4,8-dichloro-7-(2,2-dimethoxyethoxy)quinolin-2-yl]-4-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 161348186 |
| Molecular Formula | C38H41Cl3N4O7S2 |
| Molecular Weight | 836.26 g/mol |
| Exact Mass | 834.15 |
| IUPAC Name | 8-chloro-7-(2,2-dimethoxyethoxy)-2-(4-propan-2-yl-1,3-thiazol-2-yl)-1H-quinolin-4-one;2-[4,8-dichloro-7-(2,2-dimethoxyethoxy)quinolin-2-yl]-4-propan-2-yl-1,3-thiazole |
| SMILES | COC(COc1ccc2c(=O)cc(-c3nc(C(C)C)cs3)[nH]c2c1Cl)OC.COC(COc1ccc2c(Cl)cc(-c3nc(C(C)C)cs3)nc2c1Cl)OC |
| InChI | InChI=1S/C19H20Cl2N2O3S.C19H21ClN2O4S/c1-10(2)14-9-27-19(23-14)13-7-12(20)11-5-6-15(17(21)18(11)22-13)26-8-16(24-3)25-4;1-10(2)13-9-27-19(22-13)12-7-14(23)11-5-6-15(17(20)18(11)21-12)26-8-16(24-3)25-4/h5-7,9-10,16H,8H2,1-4H3;5-7,9-10,16H,8H2,1-4H3,(H,21,23) |
| InChIKey | VNOVDGZTWRLBOD-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.26 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|