C30H35NO4S2 — CID 161348265
(17R)-11,17-dihydroxy-10,13-dimethyl-17-[2-[(5-phenyl-1,3-thiazol-2-yl)sulfanyl]acetyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 161348265) has the molecular formula C30H35NO4S2 and a molecular weight of 537.75 g/mol. Its IUPAC name is (17R)-11,17-dihydroxy-10,13-dimethyl-17-[2-[(5-phenyl-1,3-thiazol-2-yl)sulfanyl]acetyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (17R)-11,17-dihydroxy-10,13-dimethyl-17-[2-[(5-phenyl-1,3-thiazol-2-yl)sulfanyl]acetyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 161348265 |
| Molecular Formula | C30H35NO4S2 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | (17R)-11,17-dihydroxy-10,13-dimethyl-17-[2-[(5-phenyl-1,3-thiazol-2-yl)sulfanyl]acetyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)CSc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C30H35NO4S2/c1-28-12-10-20(32)14-19(28)8-9-21-22-11-13-30(35,29(22,2)15-23(33)26(21)28)25(34)17-36-27-31-16-24(37-27)18-6-4-3-5-7-18/h3-7,14,16,21-23,26,33,35H,8-13,15,17H2,1-2H3/t21?,22?,23?,26?,28?,29?,30-/m0/s1 |
| InChIKey | XKBQNWDXOZLQMU-SWLCEWCVSA-N |
| XLogP | 5.71 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|