C29H28F3N4O6+ — CID 161348293
[5-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]furan-2-yl]methylazanium;2,2,2-trifluoroacetaldehyde (PubChem CID 161348293) has the molecular formula C29H28F3N4O6+ and a molecular weight of 585.56 g/mol. Its IUPAC name is [5-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]furan-2-yl]methylazanium;2,2,2-trifluoroacetaldehyde.
| Compound Name | [5-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]furan-2-yl]methylazanium;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 161348293 |
| Molecular Formula | C29H28F3N4O6+ |
| Molecular Weight | 585.56 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | [5-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]furan-2-yl]methylazanium;2,2,2-trifluoroacetaldehyde |
| SMILES | COc1ccc(-c2ccc(C[NH3+])o2)c2[nH]cc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3)c12.O=CC(F)(F)F |
| InChI | InChI=1S/C27H26N4O5.C2HF3O/c1-35-22-10-8-19(21-9-7-18(15-28)36-21)24-23(22)20(16-29-24)25(32)27(34)31-13-11-30(12-14-31)26(33)17-5-3-2-4-6-17;3-2(4,5)1-6/h2-10,16,29H,11-15,28H2,1H3;1H/p+1 |
| InChIKey | VNPCUCYDYUNBJD-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|