C21H34N2O5 — CID 161348420
tert-butyl (3aR,6R,8aS)-6-ethyl-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-8-oxo-3,3a,6,8a-tetrahydro-2H-pyrrolo[2,3-c]azepine-1-carboxylate (PubChem CID 161348420) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is tert-butyl (3aR,6R,8aS)-6-ethyl-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-8-oxo-3,3a,6,8a-tetrahydro-2H-pyrrolo[2,3-c]azepine-1-carboxylate.
| Compound Name | tert-butyl (3aR,6R,8aS)-6-ethyl-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-8-oxo-3,3a,6,8a-tetrahydro-2H-pyrrolo[2,3-c]azepine-1-carboxylate |
|---|---|
| PubChem CID | 161348420 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | tert-butyl (3aR,6R,8aS)-6-ethyl-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-8-oxo-3,3a,6,8a-tetrahydro-2H-pyrrolo[2,3-c]azepine-1-carboxylate |
| SMILES | CC[C@@H]1C=C[C@H]2CCN(C(=O)OC(C)(C)C)[C@@H]2C(=O)N1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34N2O5/c1-8-15-10-9-14-11-12-22(19(26)28-21(5,6)7)17(14)18(25)23(15)13-16(24)27-20(2,3)4/h9-10,14-15,17H,8,11-13H2,1-7H3/t14-,15+,17-/m0/s1 |
| InChIKey | OFDQWGDXAGZSFB-UXLLHSPISA-N |
| XLogP | 3.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|