C14H14F6O3S — CID 161348723
3,3-dimethyl-1-thiophen-2-ylbutan-2-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 161348723) has the molecular formula C14H14F6O3S and a molecular weight of 376.32 g/mol. Its IUPAC name is 3,3-dimethyl-1-thiophen-2-ylbutan-2-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 3,3-dimethyl-1-thiophen-2-ylbutan-2-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 161348723 |
| Molecular Formula | C14H14F6O3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 3,3-dimethyl-1-thiophen-2-ylbutan-2-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | CC(C)(C)C(=O)Cc1cccs1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14OS.C4F6O2/c1-10(2,3)9(11)7-8-5-4-6-12-8;5-3(6,7)1(11)2(12)4(8,9)10/h4-6H,7H2,1-3H3; |
| InChIKey | VNQOZKGHESDURY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|