C35H54BrN3O6 — CID 161351313
4-(2-bromoethyl)morpholine;methyl (2R)-3-(4-aminophenyl)-2-methylpropanoate;methyl (2R)-2-methyl-3-[4-(3-morpholin-4-ylpropyl)phenyl]propanoate (PubChem CID 161351313) has the molecular formula C35H54BrN3O6 and a molecular weight of 692.74 g/mol. Its IUPAC name is 4-(2-bromoethyl)morpholine;methyl (2R)-3-(4-aminophenyl)-2-methylpropanoate;methyl (2R)-2-methyl-3-[4-(3-morpholin-4-ylpropyl)phenyl]propanoate.
| Compound Name | 4-(2-bromoethyl)morpholine;methyl (2R)-3-(4-aminophenyl)-2-methylpropanoate;methyl (2R)-2-methyl-3-[4-(3-morpholin-4-ylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 161351313 |
| Molecular Formula | C35H54BrN3O6 |
| Molecular Weight | 692.74 g/mol |
| Exact Mass | 691.32 |
| IUPAC Name | 4-(2-bromoethyl)morpholine;methyl (2R)-3-(4-aminophenyl)-2-methylpropanoate;methyl (2R)-2-methyl-3-[4-(3-morpholin-4-ylpropyl)phenyl]propanoate |
| SMILES | BrCCN1CCOCC1.COC(=O)[C@H](C)Cc1ccc(CCCN2CCOCC2)cc1.COC(=O)[C@H](C)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C18H27NO3.C11H15NO2.C6H12BrNO/c1-15(18(20)21-2)14-17-7-5-16(6-8-17)4-3-9-19-10-12-22-13-11-19;1-8(11(13)14-2)7-9-3-5-10(12)6-4-9;7-1-2-8-3-5-9-6-4-8/h5-8,15H,3-4,9-14H2,1-2H3;3-6,8H,7,12H2,1-2H3;1-6H2/t15-;8-;/m11./s1 |
| InChIKey | VNYSGFIGDUZRTH-OOQUIGSJSA-N |
| XLogP | 4.64 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|