About N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen
N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen (PubChem CID 161351368) has the molecular formula C17H19ClN2O3S
and a molecular weight of 366.87 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen |
| PubChem CID | 161351368 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen |
| SMILES | CC(=O)N1CCc2cc(NS(=O)(=O)c3cccc(Cl)c3C)ccc21.[H][H] |
| InChI | InChI=1S/C17H17ClN2O3S.H2/c1-11-15(18)4-3-5-17(11)24(22,23)19-14-6-7-16-13(10-14)8-9-20(16)12(2)21;/h3-7,10,19H,8-9H2,1-2H3;1H |
| InChIKey | VNYWOAUKKMJANF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen?
The IUPAC name of N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen (CID 161351368) is N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen.
What is the SMILES notation for N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen?
The canonical SMILES for N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen is CC(=O)N1CCc2cc(NS(=O)(=O)c3cccc(Cl)c3C)ccc21.[H][H].
What is the InChIKey of N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen?
The InChIKey is VNYWOAUKKMJANF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN2O3S.H2/c1-11-15(18)4-3-5-17(11)24(22,23)19-14-6-7-16-13(10-14)8-9-20(16)12(2)21;/h3-7,10,19H,8-9H2,1-2H3;1H.
What are the key properties of N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen?
N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen has a molecular weight of 366.87 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-acetyl-2,3-dihydroindol-5-yl)-3-chloro-2-methylbenzenesulfonamide;molecular hydrogen is sourced from PubChem (CID 161351368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).