About 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine
1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine (PubChem CID 161352097) has the molecular formula C26H32N4
and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine.
Molecular Properties
| Compound Name | 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine |
| PubChem CID | 161352097 |
| Molecular Formula | C26H32N4 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine |
| SMILES | CC(C)(C)Cc1nc2ncncc2[nH]1.CC(C)(C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18.C10H14N4/c1-16(2,3)15-11-9-14(10-12-15)13-7-5-4-6-8-13;1-10(2,3)4-8-13-7-5-11-6-12-9(7)14-8/h4-12H,1-3H3;5-6H,4H2,1-3H3,(H,11,12,13,14) |
| InChIKey | VOBCHCRECPMXQR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine?
The IUPAC name of 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine (CID 161352097) is 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine.
What is the SMILES notation for 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine?
The canonical SMILES for 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine is CC(C)(C)Cc1nc2ncncc2[nH]1.CC(C)(C)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine?
The InChIKey is VOBCHCRECPMXQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.C10H14N4/c1-16(2,3)15-11-9-14(10-12-15)13-7-5-4-6-8-13;1-10(2,3)4-8-13-7-5-11-6-12-9(7)14-8/h4-12H,1-3H3;5-6H,4H2,1-3H3,(H,11,12,13,14).
What are the key properties of 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine?
1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine has a molecular weight of 400.57 g/mol, XLogP of 6.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-phenylbenzene;8-(2,2-dimethylpropyl)-7H-purine is sourced from PubChem (CID 161352097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).