C18H12NO+ — CID 161352540
13-oxa-2-azoniapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene (PubChem CID 161352540) has the molecular formula C18H12NO+ and a molecular weight of 258.30 g/mol. Its IUPAC name is 13-oxa-2-azoniapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene.
| Compound Name | 13-oxa-2-azoniapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 161352540 |
| Molecular Formula | C18H12NO+ |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 13-oxa-2-azoniapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
| SMILES | c1ccc2c(c1)Oc1cccc3c1C2[n+]1ccccc1-3 |
| InChI | InChI=1S/C18H12NO/c1-2-9-15-13(6-1)18-17-12(7-5-10-16(17)20-15)14-8-3-4-11-19(14)18/h1-11,18H/q+1 |
| InChIKey | QWSZOFZXDBJAGX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|