C39H46F3N5O5 — CID 161353872
3-[4-[4-[2-[4-[[2-(trifluoromethoxy)-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-1-yl]acetyl]piperidin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 161353872) has the molecular formula C39H46F3N5O5 and a molecular weight of 721.82 g/mol. Its IUPAC name is 3-[4-[4-[2-[4-[[2-(trifluoromethoxy)-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-1-yl]acetyl]piperidin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[2-[4-[[2-(trifluoromethoxy)-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-1-yl]acetyl]piperidin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 161353872 |
| Molecular Formula | C39H46F3N5O5 |
| Molecular Weight | 721.82 g/mol |
| Exact Mass | 721.35 |
| IUPAC Name | 3-[4-[4-[2-[4-[[2-(trifluoromethoxy)-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-1-yl]acetyl]piperidin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | Cc1c(-c2ccc(CC3CCN(CC(=O)C4CCN(c5ccc(NC6CCC(=O)NC6=O)cc5)CC4)CC3)c(OC(F)(F)F)c2)cn(C)c(=O)c1C |
| InChI | InChI=1S/C39H46F3N5O5/c1-24-25(2)38(51)45(3)22-32(24)28-4-5-29(35(21-28)52-39(40,41)42)20-26-12-16-46(17-13-26)23-34(48)27-14-18-47(19-15-27)31-8-6-30(7-9-31)43-33-10-11-36(49)44-37(33)50/h4-9,21-22,26-27,33,43H,10-20,23H2,1-3H3,(H,44,49,50) |
| InChIKey | VOGUYSKNPRGVEB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.82 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|