About potassium;5-nitro-1,2,4-triazol-3-one;perchlorate
potassium;5-nitro-1,2,4-triazol-3-one;perchlorate (PubChem CID 161354921) has the molecular formula C2ClKN4O7
and a molecular weight of 266.59 g/mol. Its IUPAC name is potassium;5-nitro-1,2,4-triazol-3-one;perchlorate.
Molecular Properties
| Compound Name | potassium;5-nitro-1,2,4-triazol-3-one;perchlorate |
| PubChem CID | 161354921 |
| Molecular Formula | C2ClKN4O7 |
| Molecular Weight | 266.59 g/mol |
| Exact Mass | 265.91 |
| IUPAC Name | potassium;5-nitro-1,2,4-triazol-3-one;perchlorate |
| SMILES | O=C1N=NC([N+](=O)[O-])=N1.[K+].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C2N4O3.ClHO4.K/c7-2-3-1(4-5-2)6(8)9;2-1(3,4)5;/h;(H,2,3,4,5);/q;;+1/p-1 |
| InChIKey | BFPACULRTNASOE-UHFFFAOYSA-M |
| XLogP | -7.55 |
| TPSA | 189.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.59 |
| LogP ≤ 5 | -7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;5-nitro-1,2,4-triazol-3-one;perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;5-nitro-1,2,4-triazol-3-one;perchlorate?
The IUPAC name of potassium;5-nitro-1,2,4-triazol-3-one;perchlorate (CID 161354921) is potassium;5-nitro-1,2,4-triazol-3-one;perchlorate.
What is the SMILES notation for potassium;5-nitro-1,2,4-triazol-3-one;perchlorate?
The canonical SMILES for potassium;5-nitro-1,2,4-triazol-3-one;perchlorate is O=C1N=NC([N+](=O)[O-])=N1.[K+].[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of potassium;5-nitro-1,2,4-triazol-3-one;perchlorate?
The InChIKey is BFPACULRTNASOE-UHFFFAOYSA-M. The full InChI is InChI=1S/C2N4O3.ClHO4.K/c7-2-3-1(4-5-2)6(8)9;2-1(3,4)5;/h;(H,2,3,4,5);/q;;+1/p-1.
What are the key properties of potassium;5-nitro-1,2,4-triazol-3-one;perchlorate?
potassium;5-nitro-1,2,4-triazol-3-one;perchlorate has a molecular weight of 266.59 g/mol, XLogP of -7.55, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;5-nitro-1,2,4-triazol-3-one;perchlorate is sourced from PubChem (CID 161354921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).