About calcium;sodium;trihydroxy(trioxidosilyloxy)silane
calcium;sodium;trihydroxy(trioxidosilyloxy)silane (PubChem CID 161355913) has the molecular formula H3CaNaO7Si2
and a molecular weight of 234.26 g/mol. Its IUPAC name is calcium;sodium;trihydroxy(trioxidosilyloxy)silane.
Molecular Properties
| Compound Name | calcium;sodium;trihydroxy(trioxidosilyloxy)silane |
| PubChem CID | 161355913 |
| Molecular Formula | H3CaNaO7Si2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 233.89 |
| IUPAC Name | calcium;sodium;trihydroxy(trioxidosilyloxy)silane |
| SMILES | [Ca+2].[Na+].[O-][Si]([O-])([O-])O[Si](O)(O)O |
| InChI | InChI=1S/Ca.Na.H3O7Si2/c;;1-8(2,3)7-9(4,5)6/h;;1-3H/q+2;+1;-3 |
| InChIKey | VONPVQKZXGNPRN-UHFFFAOYSA-N |
| XLogP | -9.44 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | -9.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze calcium;sodium;trihydroxy(trioxidosilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;sodium;trihydroxy(trioxidosilyloxy)silane?
The IUPAC name of calcium;sodium;trihydroxy(trioxidosilyloxy)silane (CID 161355913) is calcium;sodium;trihydroxy(trioxidosilyloxy)silane.
What is the SMILES notation for calcium;sodium;trihydroxy(trioxidosilyloxy)silane?
The canonical SMILES for calcium;sodium;trihydroxy(trioxidosilyloxy)silane is [Ca+2].[Na+].[O-][Si]([O-])([O-])O[Si](O)(O)O.
What is the InChIKey of calcium;sodium;trihydroxy(trioxidosilyloxy)silane?
The InChIKey is VONPVQKZXGNPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/Ca.Na.H3O7Si2/c;;1-8(2,3)7-9(4,5)6/h;;1-3H/q+2;+1;-3.
What are the key properties of calcium;sodium;trihydroxy(trioxidosilyloxy)silane?
calcium;sodium;trihydroxy(trioxidosilyloxy)silane has a molecular weight of 234.26 g/mol, XLogP of -9.44, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;sodium;trihydroxy(trioxidosilyloxy)silane is sourced from PubChem (CID 161355913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).