C33H66O5Si2 — CID 161358234
(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,8-dien-4-ol;2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,3,6-trimethyloxan-2-yl]acetaldehyde (PubChem CID 161358234) has the molecular formula C33H66O5Si2 and a molecular weight of 599.06 g/mol. Its IUPAC name is (4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,8-dien-4-ol;2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,3,6-trimethyloxan-2-yl]acetaldehyde.
| Compound Name | (4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,8-dien-4-ol;2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,3,6-trimethyloxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 161358234 |
| Molecular Formula | C33H66O5Si2 |
| Molecular Weight | 599.06 g/mol |
| Exact Mass | 598.44 |
| IUPAC Name | (4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,8-dien-4-ol;2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,3,6-trimethyloxan-2-yl]acetaldehyde |
| SMILES | C=CC[C@@H](O)C(C)(C)[C@@H](CC=C)O[Si](C)(C)C(C)(C)C.CC1C[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H](CC=O)O1 |
| InChI | InChI=1S/C17H34O2Si.C16H32O3Si/c1-10-12-14(18)17(6,7)15(13-11-2)19-20(8,9)16(3,4)5;1-12-11-14(19-20(7,8)15(2,3)4)16(5,6)13(18-12)9-10-17/h10-11,14-15,18H,1-2,12-13H2,3-9H3;10,12-14H,9,11H2,1-8H3/t14-,15-;12?,13-,14-/m11/s1 |
| InChIKey | VOVCJMPXEWEOET-LNULXPRASA-N |
| XLogP | 9.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.06 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|