About 2,4-dimethylfuran;2,3-dimethylphenol
2,4-dimethylfuran;2,3-dimethylphenol (PubChem CID 161358551) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2,4-dimethylfuran;2,3-dimethylphenol.
Molecular Properties
| Compound Name | 2,4-dimethylfuran;2,3-dimethylphenol |
| PubChem CID | 161358551 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2,4-dimethylfuran;2,3-dimethylphenol |
| SMILES | Cc1cccc(O)c1C.Cc1coc(C)c1 |
| InChI | InChI=1S/C8H10O.C6H8O/c1-6-4-3-5-8(9)7(6)2;1-5-3-6(2)7-4-5/h3-5,9H,1-2H3;3-4H,1-2H3 |
| InChIKey | VOWCYAHQKCDCPU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethylfuran;2,3-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylfuran;2,3-dimethylphenol?
The IUPAC name of 2,4-dimethylfuran;2,3-dimethylphenol (CID 161358551) is 2,4-dimethylfuran;2,3-dimethylphenol.
What is the SMILES notation for 2,4-dimethylfuran;2,3-dimethylphenol?
The canonical SMILES for 2,4-dimethylfuran;2,3-dimethylphenol is Cc1cccc(O)c1C.Cc1coc(C)c1.
What is the InChIKey of 2,4-dimethylfuran;2,3-dimethylphenol?
The InChIKey is VOWCYAHQKCDCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C6H8O/c1-6-4-3-5-8(9)7(6)2;1-5-3-6(2)7-4-5/h3-5,9H,1-2H3;3-4H,1-2H3.
What are the key properties of 2,4-dimethylfuran;2,3-dimethylphenol?
2,4-dimethylfuran;2,3-dimethylphenol has a molecular weight of 218.30 g/mol, XLogP of 3.91, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylfuran;2,3-dimethylphenol is sourced from PubChem (CID 161358551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).