C25H32IN9O3S — CID 161360468
(2R)-2-[2-[2-[(2S,4R)-4-amino-1-(6-iodoimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazol-4-yl]-2-oxoethyl]-6-(diaminomethylideneamino)-N-methylhexanamide (PubChem CID 161360468) has the molecular formula C25H32IN9O3S and a molecular weight of 665.56 g/mol. Its IUPAC name is (2R)-2-[2-[2-[(2S,4R)-4-amino-1-(6-iodoimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazol-4-yl]-2-oxoethyl]-6-(diaminomethylideneamino)-N-methylhexanamide.
| Compound Name | (2R)-2-[2-[2-[(2S,4R)-4-amino-1-(6-iodoimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazol-4-yl]-2-oxoethyl]-6-(diaminomethylideneamino)-N-methylhexanamide |
|---|---|
| PubChem CID | 161360468 |
| Molecular Formula | C25H32IN9O3S |
| Molecular Weight | 665.56 g/mol |
| Exact Mass | 665.14 |
| IUPAC Name | (2R)-2-[2-[2-[(2S,4R)-4-amino-1-(6-iodoimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazol-4-yl]-2-oxoethyl]-6-(diaminomethylideneamino)-N-methylhexanamide |
| SMILES | CNC(=O)[C@H](CCCCN=C(N)N)CC(=O)c1csc([C@@H]2C[C@@H](N)CN2C(=O)c2cn3cc(I)ccc3n2)n1 |
| InChI | InChI=1S/C25H32IN9O3S/c1-30-22(37)14(4-2-3-7-31-25(28)29)8-20(36)18-13-39-23(33-18)19-9-16(27)11-35(19)24(38)17-12-34-10-15(26)5-6-21(34)32-17/h5-6,10,12-14,16,19H,2-4,7-9,11,27H2,1H3,(H,30,37)(H4,28,29,31)/t14-,16-,19+/m1/s1 |
| InChIKey | VPCISYPMJGEJBL-OGWOLHLISA-N |
| XLogP | 1.69 |
| TPSA | 187.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|