C12H21F3N2O4S2 — CID 161360685
5-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanyl-N-propan-2-ylsulfonylpentanamide (PubChem CID 161360685) has the molecular formula C12H21F3N2O4S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 5-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanyl-N-propan-2-ylsulfonylpentanamide.
| Compound Name | 5-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanyl-N-propan-2-ylsulfonylpentanamide |
|---|---|
| PubChem CID | 161360685 |
| Molecular Formula | C12H21F3N2O4S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 5-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanyl-N-propan-2-ylsulfonylpentanamide |
| SMILES | CC(C)S(=O)(=O)NC(=O)CCCCSCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O4S2/c1-9(2)23(20,21)17-10(18)5-3-4-6-22-7-11(19)16-8-12(13,14)15/h9H,3-8H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | HXTYUWNDVCGAQY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|