About (4-aminophenoxy)mercury
(4-aminophenoxy)mercury (PubChem CID 161362227) has the molecular formula C6H6HgNO
and a molecular weight of 308.71 g/mol. Its IUPAC name is (4-aminophenoxy)mercury.
Molecular Properties
| Compound Name | (4-aminophenoxy)mercury |
| PubChem CID | 161362227 |
| Molecular Formula | C6H6HgNO |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (4-aminophenoxy)mercury |
| SMILES | Nc1ccc(O[Hg])cc1 |
| InChI | InChI=1S/C6H7NO.Hg/c7-5-1-3-6(8)4-2-5;/h1-4,8H,7H2;/q;+1/p-1 |
| InChIKey | MHNAUYBOTATGNF-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenoxy)mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenoxy)mercury?
The IUPAC name of (4-aminophenoxy)mercury (CID 161362227) is (4-aminophenoxy)mercury.
What is the SMILES notation for (4-aminophenoxy)mercury?
The canonical SMILES for (4-aminophenoxy)mercury is Nc1ccc(O[Hg])cc1.
What is the InChIKey of (4-aminophenoxy)mercury?
The InChIKey is MHNAUYBOTATGNF-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO.Hg/c7-5-1-3-6(8)4-2-5;/h1-4,8H,7H2;/q;+1/p-1.
What are the key properties of (4-aminophenoxy)mercury?
(4-aminophenoxy)mercury has a molecular weight of 308.71 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenoxy)mercury is sourced from PubChem (CID 161362227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).