About 3-hydroxyhenicosan-6-one
3-hydroxyhenicosan-6-one (PubChem CID 161363871) has the molecular formula C21H42O2
and a molecular weight of 326.56 g/mol. Its IUPAC name is 3-hydroxyhenicosan-6-one.
Molecular Properties
| Compound Name | 3-hydroxyhenicosan-6-one |
| PubChem CID | 161363871 |
| Molecular Formula | C21H42O2 |
| Molecular Weight | 326.56 g/mol |
| Exact Mass | 326.32 |
| IUPAC Name | 3-hydroxyhenicosan-6-one |
| SMILES | CCCCCCCCCCCCCCCC(=O)CCC(O)CC |
| InChI | InChI=1S/C21H42O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)19-18-20(22)4-2/h20,22H,3-19H2,1-2H3 |
| InChIKey | VPNZDYVPLAWYGC-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyhenicosan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyhenicosan-6-one?
The IUPAC name of 3-hydroxyhenicosan-6-one (CID 161363871) is 3-hydroxyhenicosan-6-one.
What is the SMILES notation for 3-hydroxyhenicosan-6-one?
The canonical SMILES for 3-hydroxyhenicosan-6-one is CCCCCCCCCCCCCCCC(=O)CCC(O)CC.
What is the InChIKey of 3-hydroxyhenicosan-6-one?
The InChIKey is VPNZDYVPLAWYGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)19-18-20(22)4-2/h20,22H,3-19H2,1-2H3.
What are the key properties of 3-hydroxyhenicosan-6-one?
3-hydroxyhenicosan-6-one has a molecular weight of 326.56 g/mol, XLogP of 6.59, 18 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyhenicosan-6-one is sourced from PubChem (CID 161363871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).