About 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine
3-chloro-2,6-dimethyl-4-propan-2-ylpyridine (PubChem CID 161364296) has the molecular formula C10H14ClN
and a molecular weight of 183.68 g/mol. Its IUPAC name is 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine.
Molecular Properties
| Compound Name | 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine |
| PubChem CID | 161364296 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine |
| SMILES | Cc1cc(C(C)C)c(Cl)c(C)n1 |
| InChI | InChI=1S/C10H14ClN/c1-6(2)9-5-7(3)12-8(4)10(9)11/h5-6H,1-4H3 |
| InChIKey | DXJIOHURPNIGEC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine?
The IUPAC name of 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine (CID 161364296) is 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine.
What is the SMILES notation for 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine?
The canonical SMILES for 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine is Cc1cc(C(C)C)c(Cl)c(C)n1.
What is the InChIKey of 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine?
The InChIKey is DXJIOHURPNIGEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN/c1-6(2)9-5-7(3)12-8(4)10(9)11/h5-6H,1-4H3.
What are the key properties of 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine?
3-chloro-2,6-dimethyl-4-propan-2-ylpyridine has a molecular weight of 183.68 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,6-dimethyl-4-propan-2-ylpyridine is sourced from PubChem (CID 161364296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).