C9H14F8 — CID 161364811
2,2-difluorobutane;1,1,1,2,3,3-hexafluoro-2-methylbutane (PubChem CID 161364811) has the molecular formula C9H14F8 and a molecular weight of 274.19 g/mol. Its IUPAC name is 2,2-difluorobutane;1,1,1,2,3,3-hexafluoro-2-methylbutane.
| Compound Name | 2,2-difluorobutane;1,1,1,2,3,3-hexafluoro-2-methylbutane |
|---|---|
| PubChem CID | 161364811 |
| Molecular Formula | C9H14F8 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2,2-difluorobutane;1,1,1,2,3,3-hexafluoro-2-methylbutane |
| SMILES | CC(F)(F)C(C)(F)C(F)(F)F.CCC(C)(F)F |
| InChI | InChI=1S/C5H6F6.C4H8F2/c1-3(6,4(2,7)8)5(9,10)11;1-3-4(2,5)6/h1-2H3;3H2,1-2H3 |
| InChIKey | VPRDTOAYXIBGNA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |