About (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane
(5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane (PubChem CID 161365649) has the molecular formula C8H6F2N2O2S
and a molecular weight of 232.21 g/mol. Its IUPAC name is (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane |
| PubChem CID | 161365649 |
| Molecular Formula | C8H6F2N2O2S |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane |
| SMILES | C=S(=O)(O)c1nc2cc(F)c(F)cc2[nH]1 |
| InChI | InChI=1S/C8H6F2N2O2S/c1-15(13,14)8-11-6-2-4(9)5(10)3-7(6)12-8/h2-3H,1H2,(H,11,12)(H,13,14) |
| InChIKey | YKRFAJIRUNZXEG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane?
The IUPAC name of (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane (CID 161365649) is (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane.
What is the SMILES notation for (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane?
The canonical SMILES for (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane is C=S(=O)(O)c1nc2cc(F)c(F)cc2[nH]1.
What is the InChIKey of (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane?
The InChIKey is YKRFAJIRUNZXEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2N2O2S/c1-15(13,14)8-11-6-2-4(9)5(10)3-7(6)12-8/h2-3H,1H2,(H,11,12)(H,13,14).
What are the key properties of (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane?
(5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane has a molecular weight of 232.21 g/mol, XLogP of 1.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-difluoro-1H-benzimidazol-2-yl)-hydroxy-methylidene-oxo-λ6-sulfane is sourced from PubChem (CID 161365649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).