C50H56Cl2N10O6 — CID 161366534
(E)-but-2-enedioic acid;bis(2-[4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]cyclopentan-1-ol) (PubChem CID 161366534) has the molecular formula C50H56Cl2N10O6 and a molecular weight of 963.97 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(2-[4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]cyclopentan-1-ol).
| Compound Name | (E)-but-2-enedioic acid;bis(2-[4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]cyclopentan-1-ol) |
|---|---|
| PubChem CID | 161366534 |
| Molecular Formula | C50H56Cl2N10O6 |
| Molecular Weight | 963.97 g/mol |
| Exact Mass | 962.38 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(2-[4-[3-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-5-yl]piperidin-1-yl]cyclopentan-1-ol) |
| SMILES | O=C(O)/C=C/C(=O)O.OC1CCCC1N1CCC(c2[nH]nc(-c3ccc(Cl)cc3)c2-c2ccncn2)CC1.OC1CCCC1N1CCC(c2[nH]nc(-c3ccc(Cl)cc3)c2-c2ccncn2)CC1 |
| InChI | InChI=1S/2C23H26ClN5O.C4H4O4/c2*24-17-6-4-15(5-7-17)22-21(18-8-11-25-14-26-18)23(28-27-22)16-9-12-29(13-10-16)19-2-1-3-20(19)30;5-3(6)1-2-4(7)8/h2*4-8,11,14,16,19-20,30H,1-3,9-10,12-13H2,(H,27,28);1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | KTMUSZZKSUVSQW-WXXKFALUSA-N |
| XLogP | 8.27 |
| TPSA | 230.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.97 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|