About ethane;naphthalene-1,5-diol;propane
ethane;naphthalene-1,5-diol;propane (PubChem CID 161367010) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;naphthalene-1,5-diol;propane.
Molecular Properties
| Compound Name | ethane;naphthalene-1,5-diol;propane |
| PubChem CID | 161367010 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | ethane;naphthalene-1,5-diol;propane |
| SMILES | CC.CC.CCC.Oc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C10H8O2.C3H8.2C2H6/c11-9-5-1-3-7-8(9)4-2-6-10(7)12;1-3-2;2*1-2/h1-6,11-12H;3H2,1-2H3;2*1-2H3 |
| InChIKey | VPYDQQLPQZFHGV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;naphthalene-1,5-diol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;naphthalene-1,5-diol;propane?
The IUPAC name of ethane;naphthalene-1,5-diol;propane (CID 161367010) is ethane;naphthalene-1,5-diol;propane.
What is the SMILES notation for ethane;naphthalene-1,5-diol;propane?
The canonical SMILES for ethane;naphthalene-1,5-diol;propane is CC.CC.CCC.Oc1cccc2c(O)cccc12.
What is the InChIKey of ethane;naphthalene-1,5-diol;propane?
The InChIKey is VPYDQQLPQZFHGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.C3H8.2C2H6/c11-9-5-1-3-7-8(9)4-2-6-10(7)12;1-3-2;2*1-2/h1-6,11-12H;3H2,1-2H3;2*1-2H3.
What are the key properties of ethane;naphthalene-1,5-diol;propane?
ethane;naphthalene-1,5-diol;propane has a molecular weight of 264.41 g/mol, XLogP of 5.72, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;naphthalene-1,5-diol;propane is sourced from PubChem (CID 161367010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).