C26H19F5O6S2 — CID 161367634
1,1,3,3,3-pentafluoro-2-(2-methylprop-2-enoyloxy)propane-1-sulfonate;10-phenylthioxanthen-10-ium-9-one (PubChem CID 161367634) has the molecular formula C26H19F5O6S2 and a molecular weight of 586.56 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(2-methylprop-2-enoyloxy)propane-1-sulfonate;10-phenylthioxanthen-10-ium-9-one.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(2-methylprop-2-enoyloxy)propane-1-sulfonate;10-phenylthioxanthen-10-ium-9-one |
|---|---|
| PubChem CID | 161367634 |
| Molecular Formula | C26H19F5O6S2 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(2-methylprop-2-enoyloxy)propane-1-sulfonate;10-phenylthioxanthen-10-ium-9-one |
| SMILES | C=C(C)C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-].O=c1c2ccccc2[s+](-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C19H13OS.C7H7F5O5S/c20-19-15-10-4-6-12-17(15)21(14-8-2-1-3-9-14)18-13-7-5-11-16(18)19;1-3(2)4(13)17-5(6(8,9)10)7(11,12)18(14,15)16/h1-13H;5H,1H2,2H3,(H,14,15,16)/q+1;/p-1 |
| InChIKey | VQAIBKDSJPUOOS-UHFFFAOYSA-M |
| XLogP | 6.27 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|