C20H26ClN3O3S3 — CID 161368577
1-[amino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]-3-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;sulfane (PubChem CID 161368577) has the molecular formula C20H26ClN3O3S3 and a molecular weight of 488.10 g/mol. Its IUPAC name is 1-[amino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]-3-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;sulfane.
| Compound Name | 1-[amino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]-3-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;sulfane |
|---|---|
| PubChem CID | 161368577 |
| Molecular Formula | C20H26ClN3O3S3 |
| Molecular Weight | 488.10 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 1-[amino-[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]-3-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;sulfane |
| SMILES | CC(C)(O)c1csc(S(N)(=O)=NC(=O)Nc2c3c(c(Cl)c4c2CCC4)CCC3)c1.S |
| InChI | InChI=1S/C20H24ClN3O3S2.H2S/c1-20(2,26)11-9-16(28-10-11)29(22,27)24-19(25)23-18-14-7-3-5-12(14)17(21)13-6-4-8-15(13)18;/h9-10,26H,3-8H2,1-2H3,(H3,22,23,24,25,27);1H2 |
| InChIKey | VQDRYUVUADSEKS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.10 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |