C20H19NO2 — CID 161368892
4-amino-3-(4-hydroxyphenyl)-1-naphthalen-2-ylbutan-2-one (PubChem CID 161368892) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-amino-3-(4-hydroxyphenyl)-1-naphthalen-2-ylbutan-2-one.
| Compound Name | 4-amino-3-(4-hydroxyphenyl)-1-naphthalen-2-ylbutan-2-one |
|---|---|
| PubChem CID | 161368892 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-amino-3-(4-hydroxyphenyl)-1-naphthalen-2-ylbutan-2-one |
| SMILES | NCC(C(=O)Cc1ccc2ccccc2c1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H19NO2/c21-13-19(16-7-9-18(22)10-8-16)20(23)12-14-5-6-15-3-1-2-4-17(15)11-14/h1-11,19,22H,12-13,21H2 |
| InChIKey | OXVHZMJQCXZQFE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |