C26H21Cl4F3N2O5 — CID 161369044
(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-(morpholine-3-carbonyl)piperidin-4-one;2,2,2-trifluoroacetic acid (PubChem CID 161369044) has the molecular formula C26H21Cl4F3N2O5 and a molecular weight of 640.27 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-(morpholine-3-carbonyl)piperidin-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-(morpholine-3-carbonyl)piperidin-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161369044 |
| Molecular Formula | C26H21Cl4F3N2O5 |
| Molecular Weight | 640.27 g/mol |
| Exact Mass | 638.02 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-(morpholine-3-carbonyl)piperidin-4-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1/C(=C/c2ccc(Cl)c(Cl)c2)CN(C(=O)C2COCCN2)C/C1=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H20Cl4N2O3.C2HF3O2/c25-18-3-1-14(9-20(18)27)7-16-11-30(24(32)22-13-33-6-5-29-22)12-17(23(16)31)8-15-2-4-19(26)21(28)10-15;3-2(4,5)1(6)7/h1-4,7-10,22,29H,5-6,11-13H2;(H,6,7)/b16-7+,17-8+; |
| InChIKey | CABTZMSMSRKHKC-YUAPUZDMSA-N |
| XLogP | 5.80 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.27 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|