C39H47N5O — CID 161371039
4-methyl-6-(2-methylbenzimidazol-1-yl)-N-phenylmethoxyhex-4-en-1-imine;2-methyl-1-(3-methylocta-2,6-dienyl)benzimidazole (PubChem CID 161371039) has the molecular formula C39H47N5O and a molecular weight of 601.84 g/mol. Its IUPAC name is 4-methyl-6-(2-methylbenzimidazol-1-yl)-N-phenylmethoxyhex-4-en-1-imine;2-methyl-1-(3-methylocta-2,6-dienyl)benzimidazole.
| Compound Name | 4-methyl-6-(2-methylbenzimidazol-1-yl)-N-phenylmethoxyhex-4-en-1-imine;2-methyl-1-(3-methylocta-2,6-dienyl)benzimidazole |
|---|---|
| PubChem CID | 161371039 |
| Molecular Formula | C39H47N5O |
| Molecular Weight | 601.84 g/mol |
| Exact Mass | 601.38 |
| IUPAC Name | 4-methyl-6-(2-methylbenzimidazol-1-yl)-N-phenylmethoxyhex-4-en-1-imine;2-methyl-1-(3-methylocta-2,6-dienyl)benzimidazole |
| SMILES | CC(=CCn1c(C)nc2ccccc21)CCC=NOCc1ccccc1.CC=CCCC(C)=CCn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C22H25N3O.C17H22N2/c1-18(9-8-15-23-26-17-20-10-4-3-5-11-20)14-16-25-19(2)24-21-12-6-7-13-22(21)25;1-4-5-6-9-14(2)12-13-19-15(3)18-16-10-7-8-11-17(16)19/h3-7,10-15H,8-9,16-17H2,1-2H3;4-5,7-8,10-12H,6,9,13H2,1-3H3 |
| InChIKey | VQLPEHGCLAHDOC-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.84 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|