About tetrafluoroborate
tetrafluoroborate (PubChem CID 161371120) has the molecular formula B3F12-3
and a molecular weight of 260.41 g/mol. Its IUPAC name is tetrafluoroborate.
Molecular Properties
| Compound Name | tetrafluoroborate |
| PubChem CID | 161371120 |
| Molecular Formula | B3F12-3 |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | tetrafluoroborate |
| SMILES | F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/3BF4/c3*2-1(3,4)5/q3*-1 |
| InChIKey | VQLWOKZZXFXCGY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrafluoroborate?
The IUPAC name of tetrafluoroborate (CID 161371120) is tetrafluoroborate.
What is the SMILES notation for tetrafluoroborate?
The canonical SMILES for tetrafluoroborate is F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.
What is the InChIKey of tetrafluoroborate?
The InChIKey is VQLWOKZZXFXCGY-UHFFFAOYSA-N. The full InChI is InChI=1S/3BF4/c3*2-1(3,4)5/q3*-1.
What are the key properties of tetrafluoroborate?
tetrafluoroborate has a molecular weight of 260.41 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrafluoroborate is sourced from PubChem (CID 161371120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).