C21H12Cl2N2O2S3 — CID 161372013
(5Z)-5-[[4-[2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 161372013) has the molecular formula C21H12Cl2N2O2S3 and a molecular weight of 491.45 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 161372013 |
| Molecular Formula | C21H12Cl2N2O2S3 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 489.94 |
| IUPAC Name | (5Z)-5-[[4-[2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1ccc(C(=O)Cc2nc(-c3ccc(Cl)c(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C21H12Cl2N2O2S3/c22-14-6-5-13(8-15(14)23)16-10-29-19(24-16)9-17(26)12-3-1-11(2-4-12)7-18-20(27)25-21(28)30-18/h1-8,10H,9H2,(H,25,27,28)/b18-7- |
| InChIKey | NSMPXPVCWDPLKQ-WSVATBPTSA-N |
| XLogP | 6.03 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|