About 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide
4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide (PubChem CID 161372422) has the molecular formula C10H21F3N2O3
and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide.
Molecular Properties
| Compound Name | 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide |
| PubChem CID | 161372422 |
| Molecular Formula | C10H21F3N2O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide |
| SMILES | NCCCCO.O=C(NCCCCO)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO2.C4H11NO/c7-6(8,9)5(12)10-3-1-2-4-11;5-3-1-2-4-6/h11H,1-4H2,(H,10,12);6H,1-5H2 |
| InChIKey | VQQDYJLZYYEGPD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide?
The IUPAC name of 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide (CID 161372422) is 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide.
What is the SMILES notation for 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide?
The canonical SMILES for 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide is NCCCCO.O=C(NCCCCO)C(F)(F)F.
What is the InChIKey of 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide?
The InChIKey is VQQDYJLZYYEGPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3NO2.C4H11NO/c7-6(8,9)5(12)10-3-1-2-4-11;5-3-1-2-4-6/h11H,1-4H2,(H,10,12);6H,1-5H2.
What are the key properties of 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide?
4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide has a molecular weight of 274.28 g/mol, XLogP of 0.16, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutan-1-ol;2,2,2-trifluoro-N-(4-hydroxybutyl)acetamide is sourced from PubChem (CID 161372422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).