C22H26N2O3 — CID 161372967
(6aR,9R)-7-methyl-4-(4-oxohexyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid (PubChem CID 161372967) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (6aR,9R)-7-methyl-4-(4-oxohexyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid.
| Compound Name | (6aR,9R)-7-methyl-4-(4-oxohexyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 161372967 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (6aR,9R)-7-methyl-4-(4-oxohexyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid |
| SMILES | CCC(=O)CCCn1cc2c3c(cccc31)C1=C[C@@H](C(=O)O)CN(C)[C@@H]1C2 |
| InChI | InChI=1S/C22H26N2O3/c1-3-16(25)6-5-9-24-13-14-11-20-18(10-15(22(26)27)12-23(20)2)17-7-4-8-19(24)21(14)17/h4,7-8,10,13,15,20H,3,5-6,9,11-12H2,1-2H3,(H,26,27)/t15-,20-/m1/s1 |
| InChIKey | BUYAMVOMVJZVED-FOIQADDNSA-N |
| XLogP | 3.35 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|