About 2,2-dimethyloxirane;methanol
2,2-dimethyloxirane;methanol (PubChem CID 161373463) has the molecular formula C5H12O2
and a molecular weight of 104.15 g/mol. Its IUPAC name is 2,2-dimethyloxirane;methanol.
Molecular Properties
| Compound Name | 2,2-dimethyloxirane;methanol |
| PubChem CID | 161373463 |
| Molecular Formula | C5H12O2 |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.08 |
| IUPAC Name | 2,2-dimethyloxirane;methanol |
| SMILES | CC1(C)CO1.CO |
| InChI | InChI=1S/C4H8O.CH4O/c1-4(2)3-5-4;1-2/h3H2,1-2H3;2H,1H3 |
| InChIKey | VQTPWNHVDWQMFM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyloxirane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyloxirane;methanol?
The IUPAC name of 2,2-dimethyloxirane;methanol (CID 161373463) is 2,2-dimethyloxirane;methanol.
What is the SMILES notation for 2,2-dimethyloxirane;methanol?
The canonical SMILES for 2,2-dimethyloxirane;methanol is CC1(C)CO1.CO.
What is the InChIKey of 2,2-dimethyloxirane;methanol?
The InChIKey is VQTPWNHVDWQMFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.CH4O/c1-4(2)3-5-4;1-2/h3H2,1-2H3;2H,1H3.
What are the key properties of 2,2-dimethyloxirane;methanol?
2,2-dimethyloxirane;methanol has a molecular weight of 104.15 g/mol, XLogP of 0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyloxirane;methanol is sourced from PubChem (CID 161373463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).