About chloroform;[dimethyl-(trimethylsilylamino)silyl]methane
chloroform;[dimethyl-(trimethylsilylamino)silyl]methane (PubChem CID 161374224) has the molecular formula C7H20Cl3NSi2
and a molecular weight of 280.78 g/mol. Its IUPAC name is chloroform;[dimethyl-(trimethylsilylamino)silyl]methane.
Molecular Properties
| Compound Name | chloroform;[dimethyl-(trimethylsilylamino)silyl]methane |
| PubChem CID | 161374224 |
| Molecular Formula | C7H20Cl3NSi2 |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | chloroform;[dimethyl-(trimethylsilylamino)silyl]methane |
| SMILES | C[Si](C)(C)N[Si](C)(C)C.ClC(Cl)Cl |
| InChI | InChI=1S/C6H19NSi2.CHCl3/c1-8(2,3)7-9(4,5)6;2-1(3)4/h7H,1-6H3;1H |
| InChIKey | VQWDDLRGTOVUKL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chloroform;[dimethyl-(trimethylsilylamino)silyl]methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;[dimethyl-(trimethylsilylamino)silyl]methane?
The IUPAC name of chloroform;[dimethyl-(trimethylsilylamino)silyl]methane (CID 161374224) is chloroform;[dimethyl-(trimethylsilylamino)silyl]methane.
What is the SMILES notation for chloroform;[dimethyl-(trimethylsilylamino)silyl]methane?
The canonical SMILES for chloroform;[dimethyl-(trimethylsilylamino)silyl]methane is C[Si](C)(C)N[Si](C)(C)C.ClC(Cl)Cl.
What is the InChIKey of chloroform;[dimethyl-(trimethylsilylamino)silyl]methane?
The InChIKey is VQWDDLRGTOVUKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H19NSi2.CHCl3/c1-8(2,3)7-9(4,5)6;2-1(3)4/h7H,1-6H3;1H.
What are the key properties of chloroform;[dimethyl-(trimethylsilylamino)silyl]methane?
chloroform;[dimethyl-(trimethylsilylamino)silyl]methane has a molecular weight of 280.78 g/mol, XLogP of 4.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;[dimethyl-(trimethylsilylamino)silyl]methane is sourced from PubChem (CID 161374224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).