C28H33NO3 — CID 161374350
(3aR,8bS)-3,3a,4,8b-tetrahydroindeno[1,2-b]furan-2-one;1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-2-(2-prop-2-enylphenyl)ethanone (PubChem CID 161374350) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is (3aR,8bS)-3,3a,4,8b-tetrahydroindeno[1,2-b]furan-2-one;1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-2-(2-prop-2-enylphenyl)ethanone.
| Compound Name | (3aR,8bS)-3,3a,4,8b-tetrahydroindeno[1,2-b]furan-2-one;1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-2-(2-prop-2-enylphenyl)ethanone |
|---|---|
| PubChem CID | 161374350 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (3aR,8bS)-3,3a,4,8b-tetrahydroindeno[1,2-b]furan-2-one;1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-2-(2-prop-2-enylphenyl)ethanone |
| SMILES | C=CCc1ccccc1CC(=O)N1[C@H](C)CC[C@H]1C.O=C1C[C@H]2Cc3ccccc3[C@H]2O1 |
| InChI | InChI=1S/C17H23NO.C11H10O2/c1-4-7-15-8-5-6-9-16(15)12-17(19)18-13(2)10-11-14(18)3;12-10-6-8-5-7-3-1-2-4-9(7)11(8)13-10/h4-6,8-9,13-14H,1,7,10-12H2,2-3H3;1-4,8,11H,5-6H2/t13-,14-;8-,11+/m11/s1 |
| InChIKey | VQWNVKRYEQUOGD-MIKNALAPSA-N |
| XLogP | 5.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|