About sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide
sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide (PubChem CID 161375907) has the molecular formula C22H29N2NaO
and a molecular weight of 360.48 g/mol. Its IUPAC name is sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide.
Molecular Properties
| Compound Name | sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide |
| PubChem CID | 161375907 |
| Molecular Formula | C22H29N2NaO |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide |
| SMILES | CC(C)c1cccc(C(C)C)c1[N-]C(=O)N(C)C(C)c1ccccc1.[Na+] |
| InChI | InChI=1S/C22H30N2O.Na/c1-15(2)19-13-10-14-20(16(3)4)21(19)23-22(25)24(6)17(5)18-11-8-7-9-12-18;/h7-17H,1-6H3,(H,23,25);/q;+1/p-1 |
| InChIKey | JZISWFAYXCHKDC-UHFFFAOYSA-M |
| XLogP | 3.76 |
| TPSA | 34.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide?
The IUPAC name of sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide (CID 161375907) is sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide.
What is the SMILES notation for sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide?
The canonical SMILES for sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide is CC(C)c1cccc(C(C)C)c1[N-]C(=O)N(C)C(C)c1ccccc1.[Na+].
What is the InChIKey of sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide?
The InChIKey is JZISWFAYXCHKDC-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H30N2O.Na/c1-15(2)19-13-10-14-20(16(3)4)21(19)23-22(25)24(6)17(5)18-11-8-7-9-12-18;/h7-17H,1-6H3,(H,23,25);/q;+1/p-1.
What are the key properties of sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide?
sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide has a molecular weight of 360.48 g/mol, XLogP of 3.76, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [2,6-di(propan-2-yl)phenyl]-[methyl(1-phenylethyl)carbamoyl]azanide is sourced from PubChem (CID 161375907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).