C22H25NO2S — CID 161377297
4-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)sulfonylmethyl]aniline (PubChem CID 161377297) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is 4-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)sulfonylmethyl]aniline.
| Compound Name | 4-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)sulfonylmethyl]aniline |
|---|---|
| PubChem CID | 161377297 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 4-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)sulfonylmethyl]aniline |
| SMILES | Cc1cc(S(=O)(=O)Cc2ccc(N)cc2)c2c(C)ccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C22H25NO2S/c1-14(2)18-8-5-15(3)22-20(12-18)16(4)11-21(22)26(24,25)13-17-6-9-19(23)10-7-17/h5-12,14H,13,23H2,1-4H3 |
| InChIKey | VRFWQKMBLLDZAF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|