piperidine;sulfamic acid

C5H14N2O3S — CID 161377402

IUPACpiperidine;sulfamic acid
SMILESC1CCNCC1.NS(=O)(=O)O
InChIInChI=1S/C5H11N.H3NO3S/c1-2-4-6-5-3-1;1-5(2,3)4/h6H,1-5H2;(H3,1,2,3,4)
InChIKeyVRGGGAIRTCANAR-UHFFFAOYSA-N
MW182.24 g/mol
LogP-0.49
Rot. Bonds

About piperidine;sulfamic acid

piperidine;sulfamic acid (PubChem CID 161377402) has the molecular formula C5H14N2O3S and a molecular weight of 182.24 g/mol. Its IUPAC name is piperidine;sulfamic acid.

Molecular Properties

Compound Namepiperidine;sulfamic acid
PubChem CID161377402
Molecular FormulaC5H14N2O3S
Molecular Weight182.24 g/mol
Exact Mass182.07
IUPAC Namepiperidine;sulfamic acid
SMILESC1CCNCC1.NS(=O)(=O)O
InChIInChI=1S/C5H11N.H3NO3S/c1-2-4-6-5-3-1;1-5(2,3)4/h6H,1-5H2;(H3,1,2,3,4)
InChIKeyVRGGGAIRTCANAR-UHFFFAOYSA-N
XLogP-0.49
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.24
LogP ≤ 5-0.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze piperidine;sulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperidine;sulfamic acid?
The IUPAC name of piperidine;sulfamic acid (CID 161377402) is piperidine;sulfamic acid.
What is the SMILES notation for piperidine;sulfamic acid?
The canonical SMILES for piperidine;sulfamic acid is C1CCNCC1.NS(=O)(=O)O.
What is the InChIKey of piperidine;sulfamic acid?
The InChIKey is VRGGGAIRTCANAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.H3NO3S/c1-2-4-6-5-3-1;1-5(2,3)4/h6H,1-5H2;(H3,1,2,3,4).
What are the key properties of piperidine;sulfamic acid?
piperidine;sulfamic acid has a molecular weight of 182.24 g/mol, XLogP of -0.49, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;sulfamic acid is sourced from PubChem (CID 161377402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).