About 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde
6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde (PubChem CID 161377615) has the molecular formula C12H11ClFN3O2
and a molecular weight of 283.69 g/mol. Its IUPAC name is 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde |
| PubChem CID | 161377615 |
| Molecular Formula | C12H11ClFN3O2 |
| Molecular Weight | 283.69 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde |
| SMILES | COc1ncc(F)cc1C=O.Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C7H6FNO2.C5H5ClN2/c1-11-7-5(4-10)2-6(8)3-9-7;6-4-2-1-3-5(7)8-4/h2-4H,1H3;1-3H,(H2,7,8) |
| InChIKey | VRGZNIJLKAMFBV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.69 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde?
The IUPAC name of 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde (CID 161377615) is 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde.
What is the SMILES notation for 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde?
The canonical SMILES for 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde is COc1ncc(F)cc1C=O.Nc1cccc(Cl)n1.
What is the InChIKey of 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde?
The InChIKey is VRGZNIJLKAMFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO2.C5H5ClN2/c1-11-7-5(4-10)2-6(8)3-9-7;6-4-2-1-3-5(7)8-4/h2-4H,1H3;1-3H,(H2,7,8).
What are the key properties of 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde?
6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde has a molecular weight of 283.69 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloropyridin-2-amine;5-fluoro-2-methoxypyridine-3-carbaldehyde is sourced from PubChem (CID 161377615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).