C14H8ClF3N4O — CID 161378012
1-(2-chloro-3-pyridinyl)-4-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 161378012) has the molecular formula C14H8ClF3N4O and a molecular weight of 340.69 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)-4-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 1-(2-chloro-3-pyridinyl)-4-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 161378012 |
| Molecular Formula | C14H8ClF3N4O |
| Molecular Weight | 340.69 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)-4-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | Cc1nc(=O)n(-c2cccnc2Cl)c2nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C14H8ClF3N4O/c1-7-8-4-5-10(14(16,17)18)21-12(8)22(13(23)20-7)9-3-2-6-19-11(9)15/h2-6H,1H3 |
| InChIKey | VRIJBLOQVKDQIV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.69 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|