C98H176Cl4N14O49P4S2 — CID 161378198
CID 161378198 (PubChem CID 161378198) has the molecular formula C98H176Cl4N14O49P4S2 and a molecular weight of 2664.38 g/mol.
| Compound Name | CID 161378198 |
|---|---|
| PubChem CID | 161378198 |
| Molecular Formula | C98H176Cl4N14O49P4S2 |
| Molecular Weight | 2664.38 g/mol |
| Exact Mass | 2660.89 |
| IUPAC Name | — |
| SMILES | Nc1nc(=O)n([C@@H]2O[C@H](CO)C(O)[C@@H]2O)cc1CCCNC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.Nc1nc(=O)n([C@@H]2O[C@H](COP(=O)(O)O)C(OP(=O)(O)O)[C@@H]2O)cc1CCCNC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.O=P(Cl)(Cl)OP(=O)(Cl)Cl |
| InChI | InChI=1S/C49H89N7O26P2S.C49H87N7O20S.Cl4O3P2/c50-46-37(34-56(49(61)55-46)47-44(59)45(82-84(65,66)67)39(81-47)35-80-83(62,63)64)4-3-8-51-42(58)7-10-68-12-14-70-16-18-72-20-22-74-24-26-76-28-30-78-32-33-79-31-29-77-27-25-75-23-21-73-19-17-71-15-13-69-11-9-52-41(57)6-2-1-5-40-43-38(36-85-40)53-48(60)54-43;50-46-37(34-56(49(63)55-46)47-45(61)44(60)39(35-57)76-47)4-3-8-51-42(59)7-10-64-12-14-66-16-18-68-20-22-70-24-26-72-28-30-74-32-33-75-31-29-73-27-25-71-23-21-69-19-17-67-15-13-65-11-9-52-41(58)6-2-1-5-40-43-38(36-77-40)53-48(62)54-43;1-8(2,5)7-9(3,4)6/h34,38-40,43-45,47,59H,1-33,35-36H2,(H,51,58)(H,52,57)(H2,50,55,61)(H2,53,54,60)(H2,62,63,64)(H2,65,66,67);34,38-40,43-45,47,57,60-61H,1-33,35-36H2,(H,51,59)(H,52,58)(H2,50,55,63)(H2,53,54,62);/t38-,39+,40-,43-,44-,45?,47+;38-,39+,40-,43-,44?,45-,47+;/m00./s1 |
| InChIKey | VRIZOFSQFKJOEM-GOULVMPOSA-N |
| XLogP | 0.24 |
| TPSA | 818.27 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 53 |
| Rotatable Bonds | 106 |
| Heavy Atoms | 171 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2664.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 53 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|