About butan-2-one;butyl octadecanoate
butan-2-one;butyl octadecanoate (PubChem CID 161382487) has the molecular formula C26H52O3
and a molecular weight of 412.70 g/mol. Its IUPAC name is butan-2-one;butyl octadecanoate.
Molecular Properties
| Compound Name | butan-2-one;butyl octadecanoate |
| PubChem CID | 161382487 |
| Molecular Formula | C26H52O3 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.39 |
| IUPAC Name | butan-2-one;butyl octadecanoate |
| SMILES | CCC(C)=O.CCCCCCCCCCCCCCCCCC(=O)OCCCC |
| InChI | InChI=1S/C22H44O2.C4H8O/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(23)24-21-6-4-2;1-3-4(2)5/h3-21H2,1-2H3;3H2,1-2H3 |
| InChIKey | VRXAQKMPZKGHIH-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;butyl octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;butyl octadecanoate?
The IUPAC name of butan-2-one;butyl octadecanoate (CID 161382487) is butan-2-one;butyl octadecanoate.
What is the SMILES notation for butan-2-one;butyl octadecanoate?
The canonical SMILES for butan-2-one;butyl octadecanoate is CCC(C)=O.CCCCCCCCCCCCCCCCCC(=O)OCCCC.
What is the InChIKey of butan-2-one;butyl octadecanoate?
The InChIKey is VRXAQKMPZKGHIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2.C4H8O/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(23)24-21-6-4-2;1-3-4(2)5/h3-21H2,1-2H3;3H2,1-2H3.
What are the key properties of butan-2-one;butyl octadecanoate?
butan-2-one;butyl octadecanoate has a molecular weight of 412.70 g/mol, XLogP of 8.58, 20 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;butyl octadecanoate is sourced from PubChem (CID 161382487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).