C22H16F20 — CID 161382497
cyclopenta-1,3-diene;5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)bicyclo[2.2.1]hept-2-ene;(E)-1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene (PubChem CID 161382497) has the molecular formula C22H16F20 and a molecular weight of 660.33 g/mol. Its IUPAC name is cyclopenta-1,3-diene;5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)bicyclo[2.2.1]hept-2-ene;(E)-1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene.
| Compound Name | cyclopenta-1,3-diene;5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)bicyclo[2.2.1]hept-2-ene;(E)-1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 161382497 |
| Molecular Formula | C22H16F20 |
| Molecular Weight | 660.33 g/mol |
| Exact Mass | 660.09 |
| IUPAC Name | cyclopenta-1,3-diene;5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)bicyclo[2.2.1]hept-2-ene;(E)-1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene |
| SMILES | C1=CCC=C1.FC(F)(F)/C=C/C(F)(C(F)(F)F)C(F)(F)F.FC(F)(F)C1C2C=CC(C2)C1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F10.C6H2F10.C5H6/c12-8(10(16,17)18,11(19,20)21)6-4-1-2-5(3-4)7(6)9(13,14)15;7-3(5(11,12)13,6(14,15)16)1-2-4(8,9)10;1-2-4-5-3-1/h1-2,4-7H,3H2;1-2H;1-4H,5H2/b;2-1+; |
| InChIKey | VRXBKXIQMSHUHQ-JITBQSAISA-N |
| XLogP | 10.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.33 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|