About 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine
2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine (PubChem CID 161385586) has the molecular formula C13H19NS
and a molecular weight of 221.37 g/mol. Its IUPAC name is 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine |
| PubChem CID | 161385586 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine |
| SMILES | C=C1C=CNc2ccsc21.CC(C)(C)C |
| InChI | InChI=1S/C8H7NS.C5H12/c1-6-2-4-9-7-3-5-10-8(6)7;1-5(2,3)4/h2-5,9H,1H2;1-4H3 |
| InChIKey | VSHKAMHZZYEDTF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine?
The IUPAC name of 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine (CID 161385586) is 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine.
What is the SMILES notation for 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine?
The canonical SMILES for 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine is C=C1C=CNc2ccsc21.CC(C)(C)C.
What is the InChIKey of 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine?
The InChIKey is VSHKAMHZZYEDTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS.C5H12/c1-6-2-4-9-7-3-5-10-8(6)7;1-5(2,3)4/h2-5,9H,1H2;1-4H3.
What are the key properties of 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine?
2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine has a molecular weight of 221.37 g/mol, XLogP of 4.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane;7-methylidene-4H-thieno[3,2-b]pyridine is sourced from PubChem (CID 161385586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).