About 1-isocyano-2,4,5-trimethylbenzene
1-isocyano-2,4,5-trimethylbenzene (PubChem CID 161386679) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 1-isocyano-2,4,5-trimethylbenzene.
Molecular Properties
| Compound Name | 1-isocyano-2,4,5-trimethylbenzene |
| PubChem CID | 161386679 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 1-isocyano-2,4,5-trimethylbenzene |
| SMILES | [C-]#[N+]c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C10H11N/c1-7-5-9(3)10(11-4)6-8(7)2/h5-6H,1-3H3 |
| InChIKey | HHNBBJJPFMEZEC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyano-2,4,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyano-2,4,5-trimethylbenzene?
The IUPAC name of 1-isocyano-2,4,5-trimethylbenzene (CID 161386679) is 1-isocyano-2,4,5-trimethylbenzene.
What is the SMILES notation for 1-isocyano-2,4,5-trimethylbenzene?
The canonical SMILES for 1-isocyano-2,4,5-trimethylbenzene is [C-]#[N+]c1cc(C)c(C)cc1C.
What is the InChIKey of 1-isocyano-2,4,5-trimethylbenzene?
The InChIKey is HHNBBJJPFMEZEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-7-5-9(3)10(11-4)6-8(7)2/h5-6H,1-3H3.
What are the key properties of 1-isocyano-2,4,5-trimethylbenzene?
1-isocyano-2,4,5-trimethylbenzene has a molecular weight of 145.20 g/mol, XLogP of 3.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyano-2,4,5-trimethylbenzene is sourced from PubChem (CID 161386679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).