C18H24BClF2N2O4 — CID 161388695
[1-[[4-[(2S)-1-(4-chloro-2,6-difluorophenyl)azetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 161388695) has the molecular formula C18H24BClF2N2O4 and a molecular weight of 416.66 g/mol. Its IUPAC name is [1-[[4-[(2S)-1-(4-chloro-2,6-difluorophenyl)azetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [1-[[4-[(2S)-1-(4-chloro-2,6-difluorophenyl)azetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 161388695 |
| Molecular Formula | C18H24BClF2N2O4 |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [1-[[4-[(2S)-1-(4-chloro-2,6-difluorophenyl)azetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)CCC(=O)[C@@H]1CCN1c1c(F)cc(Cl)cc1F)B(O)O |
| InChI | InChI=1S/C18H24BClF2N2O4/c1-10(2)7-16(19(27)28)23-17(26)4-3-15(25)14-5-6-24(14)18-12(21)8-11(20)9-13(18)22/h8-10,14,16,27-28H,3-7H2,1-2H3,(H,23,26)/t14-,16?/m0/s1 |
| InChIKey | VSRMXMBCQYTIOB-LBAUFKAWSA-N |
| XLogP | 2.09 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|